C15H21NO2 — CID 103870017
2-ethyl-N-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]butanamide (PubChem CID 103870017) has the molecular formula C15H21NO2 and a molecular weight of 247.34 g/mol. Its IUPAC name is 2-ethyl-N-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]butanamide.
| Compound Name | 2-ethyl-N-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]butanamide |
|---|---|
| PubChem CID | 103870017 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | 2-ethyl-N-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]butanamide |
| SMILES | CCC(CC)C(=O)N[C@@H]1c2ccccc2C[C@@H]1O |
| InChI | InChI=1S/C15H21NO2/c1-3-10(4-2)15(18)16-14-12-8-6-5-7-11(12)9-13(14)17/h5-8,10,13-14,17H,3-4,9H2,1-2H3,(H,16,18)/t13-,14+/m0/s1 |
| InChIKey | JCVHZMLZTAMEOE-UONOGXRCSA-N |
| XLogP | 2.20 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |