C17H24ClNO — CID 114302098
N-(2-chloro-2,3-dihydro-1H-inden-1-yl)-2-ethylhexanamide (PubChem CID 114302098) has the molecular formula C17H24ClNO and a molecular weight of 293.84 g/mol. Its IUPAC name is N-(2-chloro-2,3-dihydro-1H-inden-1-yl)-2-ethylhexanamide.
| Compound Name | N-(2-chloro-2,3-dihydro-1H-inden-1-yl)-2-ethylhexanamide |
|---|---|
| PubChem CID | 114302098 |
| Molecular Formula | C17H24ClNO |
| Molecular Weight | 293.84 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | N-(2-chloro-2,3-dihydro-1H-inden-1-yl)-2-ethylhexanamide |
| SMILES | CCCCC(CC)C(=O)NC1c2ccccc2CC1Cl |
| InChI | InChI=1S/C17H24ClNO/c1-3-5-8-12(4-2)17(20)19-16-14-10-7-6-9-13(14)11-15(16)18/h6-7,9-10,12,15-16H,3-5,8,11H2,1-2H3,(H,19,20) |
| InChIKey | FNXWLBYYPJYMPE-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.84 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|