C18H19NO2 — CID 70273214
N-[(1R,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-2-phenylpropanamide (PubChem CID 70273214) has the molecular formula C18H19NO2 and a molecular weight of 281.36 g/mol. Its IUPAC name is N-[(1R,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-2-phenylpropanamide.
| Compound Name | N-[(1R,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-2-phenylpropanamide |
|---|---|
| PubChem CID | 70273214 |
| Molecular Formula | C18H19NO2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | N-[(1R,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-2-phenylpropanamide |
| SMILES | CC(C(=O)N[C@@H]1c2ccccc2C[C@H]1O)c1ccccc1 |
| InChI | InChI=1S/C18H19NO2/c1-12(13-7-3-2-4-8-13)18(21)19-17-15-10-6-5-9-14(15)11-16(17)20/h2-10,12,16-17,20H,11H2,1H3,(H,19,21)/t12?,16-,17-/m1/s1 |
| InChIKey | IHKHJDNYAKDPKP-RIJFORKLSA-N |
| XLogP | 2.56 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |