C19H28ClNO5 — CID 68933398
diethyl 2-[(1S,2R)-2-amino-2,3-dihydro-1H-inden-1-yl]-2-(2-methoxyethyl)propanedioate;hydrochloride (PubChem CID 68933398) has the molecular formula C19H28ClNO5 and a molecular weight of 385.89 g/mol. Its IUPAC name is diethyl 2-[(1S,2R)-2-amino-2,3-dihydro-1H-inden-1-yl]-2-(2-methoxyethyl)propanedioate;hydrochloride.
| Compound Name | diethyl 2-[(1S,2R)-2-amino-2,3-dihydro-1H-inden-1-yl]-2-(2-methoxyethyl)propanedioate;hydrochloride |
|---|---|
| PubChem CID | 68933398 |
| Molecular Formula | C19H28ClNO5 |
| Molecular Weight | 385.89 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | diethyl 2-[(1S,2R)-2-amino-2,3-dihydro-1H-inden-1-yl]-2-(2-methoxyethyl)propanedioate;hydrochloride |
| SMILES | CCOC(=O)C(CCOC)(C(=O)OCC)[C@@H]1c2ccccc2C[C@H]1N.Cl |
| InChI | InChI=1S/C19H27NO5.ClH/c1-4-24-17(21)19(10-11-23-3,18(22)25-5-2)16-14-9-7-6-8-13(14)12-15(16)20;/h6-9,15-16H,4-5,10-12,20H2,1-3H3;1H/t15-,16-;/m1./s1 |
| InChIKey | FLJWXGRKTQEBQZ-QNBGGDODSA-N |
| XLogP | 2.22 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.89 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|