C23H33NO7 — CID 59355884
dimethyl 2-(2-ethoxyethyl)-2-[(1S,2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2,3-dihydro-1H-inden-1-yl]propanedioate (PubChem CID 59355884) has the molecular formula C23H33NO7 and a molecular weight of 435.52 g/mol. Its IUPAC name is dimethyl 2-(2-ethoxyethyl)-2-[(1S,2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2,3-dihydro-1H-inden-1-yl]propanedioate.
| Compound Name | dimethyl 2-(2-ethoxyethyl)-2-[(1S,2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2,3-dihydro-1H-inden-1-yl]propanedioate |
|---|---|
| PubChem CID | 59355884 |
| Molecular Formula | C23H33NO7 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.23 |
| IUPAC Name | dimethyl 2-(2-ethoxyethyl)-2-[(1S,2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2,3-dihydro-1H-inden-1-yl]propanedioate |
| SMILES | CCOCCC(C(=O)OC)(C(=O)OC)[C@@H]1c2ccccc2C[C@H]1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H33NO7/c1-7-30-13-12-23(19(25)28-5,20(26)29-6)18-16-11-9-8-10-15(16)14-17(18)24-21(27)31-22(2,3)4/h8-11,17-18H,7,12-14H2,1-6H3,(H,24,27)/t17-,18-/m1/s1 |
| InChIKey | IEMVRHUGCWUSOO-QZTJIDSGSA-N |
| XLogP | 2.98 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|