C14H15NO2 — CID 114028589
N-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]pent-4-ynamide (PubChem CID 114028589) has the molecular formula C14H15NO2 and a molecular weight of 229.28 g/mol. Its IUPAC name is N-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]pent-4-ynamide.
| Compound Name | N-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]pent-4-ynamide |
|---|---|
| PubChem CID | 114028589 |
| Molecular Formula | C14H15NO2 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | N-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]pent-4-ynamide |
| SMILES | C#CCCC(=O)N[C@H]1c2ccccc2C[C@H]1O |
| InChI | InChI=1S/C14H15NO2/c1-2-3-8-13(17)15-14-11-7-5-4-6-10(11)9-12(14)16/h1,4-7,12,14,16H,3,8-9H2,(H,15,17)/t12-,14+/m1/s1 |
| InChIKey | DDGCVKRCDRSHPC-OCCSQVGLSA-N |
| XLogP | 1.17 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|