C17H25NO2 — CID 103816825
N-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]octanamide (PubChem CID 103816825) has the molecular formula C17H25NO2 and a molecular weight of 275.39 g/mol. Its IUPAC name is N-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]octanamide.
| Compound Name | N-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]octanamide |
|---|---|
| PubChem CID | 103816825 |
| Molecular Formula | C17H25NO2 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | N-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]octanamide |
| SMILES | CCCCCCCC(=O)N[C@H]1c2ccccc2C[C@H]1O |
| InChI | InChI=1S/C17H25NO2/c1-2-3-4-5-6-11-16(20)18-17-14-10-8-7-9-13(14)12-15(17)19/h7-10,15,17,19H,2-6,11-12H2,1H3,(H,18,20)/t15-,17+/m1/s1 |
| InChIKey | DJJMLWDAUCMQME-WBVHZDCISA-N |
| XLogP | 3.12 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|