C15H21NO2S — CID 61368363
2-butylsulfanyl-N-(2-hydroxy-2,3-dihydro-1H-inden-1-yl)acetamide (PubChem CID 61368363) has the molecular formula C15H21NO2S and a molecular weight of 279.41 g/mol. Its IUPAC name is 2-butylsulfanyl-N-(2-hydroxy-2,3-dihydro-1H-inden-1-yl)acetamide.
| Compound Name | 2-butylsulfanyl-N-(2-hydroxy-2,3-dihydro-1H-inden-1-yl)acetamide |
|---|---|
| PubChem CID | 61368363 |
| Molecular Formula | C15H21NO2S |
| Molecular Weight | 279.41 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 2-butylsulfanyl-N-(2-hydroxy-2,3-dihydro-1H-inden-1-yl)acetamide |
| SMILES | CCCCSCC(=O)NC1c2ccccc2CC1O |
| InChI | InChI=1S/C15H21NO2S/c1-2-3-8-19-10-14(18)16-15-12-7-5-4-6-11(12)9-13(15)17/h4-7,13,15,17H,2-3,8-10H2,1H3,(H,16,18) |
| InChIKey | DDRPCQBGMNWGNQ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.41 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|