C13H16ClNO2 — CID 107216794
4-chloro-N-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]butanamide (PubChem CID 107216794) has the molecular formula C13H16ClNO2 and a molecular weight of 253.73 g/mol. Its IUPAC name is 4-chloro-N-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]butanamide.
| Compound Name | 4-chloro-N-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]butanamide |
|---|---|
| PubChem CID | 107216794 |
| Molecular Formula | C13H16ClNO2 |
| Molecular Weight | 253.73 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 4-chloro-N-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]butanamide |
| SMILES | O=C(CCCCl)N[C@@H]1c2ccccc2C[C@@H]1O |
| InChI | InChI=1S/C13H16ClNO2/c14-7-3-6-12(17)15-13-10-5-2-1-4-9(10)8-11(13)16/h1-2,4-5,11,13,16H,3,6-8H2,(H,15,17)/t11-,13+/m0/s1 |
| InChIKey | GCVXAFPGPDEVCD-WCQYABFASA-N |
| XLogP | 1.78 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.73 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|