C13H15ClN2O4 — CID 134871769
4-chloro-N-[(1R,2R)-2-hydroxy-6-nitro-2,3-dihydro-1H-inden-1-yl]butanamide (PubChem CID 134871769) has the molecular formula C13H15ClN2O4 and a molecular weight of 298.73 g/mol. Its IUPAC name is 4-chloro-N-[(1R,2R)-2-hydroxy-6-nitro-2,3-dihydro-1H-inden-1-yl]butanamide.
| Compound Name | 4-chloro-N-[(1R,2R)-2-hydroxy-6-nitro-2,3-dihydro-1H-inden-1-yl]butanamide |
|---|---|
| PubChem CID | 134871769 |
| Molecular Formula | C13H15ClN2O4 |
| Molecular Weight | 298.73 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | 4-chloro-N-[(1R,2R)-2-hydroxy-6-nitro-2,3-dihydro-1H-inden-1-yl]butanamide |
| SMILES | O=C(CCCCl)N[C@@H]1c2cc([N+](=O)[O-])ccc2C[C@H]1O |
| InChI | InChI=1S/C13H15ClN2O4/c14-5-1-2-12(18)15-13-10-7-9(16(19)20)4-3-8(10)6-11(13)17/h3-4,7,11,13,17H,1-2,5-6H2,(H,15,18)/t11-,13-/m1/s1 |
| InChIKey | XTTPPVPBKGIRIU-DGCLKSJQSA-N |
| XLogP | 1.69 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.73 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|