C15H12Cl2N2O3 — CID 133442202
1-(2,6-dichloro-4-nitroanilino)-2,3-dihydro-1H-inden-2-ol (PubChem CID 133442202) has the molecular formula C15H12Cl2N2O3 and a molecular weight of 339.18 g/mol. Its IUPAC name is 1-(2,6-dichloro-4-nitroanilino)-2,3-dihydro-1H-inden-2-ol.
| Compound Name | 1-(2,6-dichloro-4-nitroanilino)-2,3-dihydro-1H-inden-2-ol |
|---|---|
| PubChem CID | 133442202 |
| Molecular Formula | C15H12Cl2N2O3 |
| Molecular Weight | 339.18 g/mol |
| Exact Mass | 338.02 |
| IUPAC Name | 1-(2,6-dichloro-4-nitroanilino)-2,3-dihydro-1H-inden-2-ol |
| SMILES | O=[N+]([O-])c1cc(Cl)c(NC2c3ccccc3CC2O)c(Cl)c1 |
| InChI | InChI=1S/C15H12Cl2N2O3/c16-11-6-9(19(21)22)7-12(17)15(11)18-14-10-4-2-1-3-8(10)5-13(14)20/h1-4,6-7,13-14,18,20H,5H2 |
| InChIKey | RORJTGWVCFHMIK-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 75.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.18 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|