C16H15ClN2O3 — CID 111440129
(1R,2S)-1-[(5-chloro-2-nitrophenyl)methylamino]-2,3-dihydro-1H-inden-2-ol (PubChem CID 111440129) has the molecular formula C16H15ClN2O3 and a molecular weight of 318.76 g/mol. Its IUPAC name is (1R,2S)-1-[(5-chloro-2-nitrophenyl)methylamino]-2,3-dihydro-1H-inden-2-ol.
| Compound Name | (1R,2S)-1-[(5-chloro-2-nitrophenyl)methylamino]-2,3-dihydro-1H-inden-2-ol |
|---|---|
| PubChem CID | 111440129 |
| Molecular Formula | C16H15ClN2O3 |
| Molecular Weight | 318.76 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | (1R,2S)-1-[(5-chloro-2-nitrophenyl)methylamino]-2,3-dihydro-1H-inden-2-ol |
| SMILES | O=[N+]([O-])c1ccc(Cl)cc1CN[C@@H]1c2ccccc2C[C@@H]1O |
| InChI | InChI=1S/C16H15ClN2O3/c17-12-5-6-14(19(21)22)11(7-12)9-18-16-13-4-2-1-3-10(13)8-15(16)20/h1-7,15-16,18,20H,8-9H2/t15-,16+/m0/s1 |
| InChIKey | SCDBEFFIQHRMHL-JKSUJKDBSA-N |
| XLogP | 3.00 |
| TPSA | 75.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.76 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|