C12H15ClN2O2 — CID 78998674
N-[(5-chloro-2-nitrophenyl)methyl]-2,2-dimethylcyclopropan-1-amine (PubChem CID 78998674) has the molecular formula C12H15ClN2O2 and a molecular weight of 254.72 g/mol. Its IUPAC name is N-[(5-chloro-2-nitrophenyl)methyl]-2,2-dimethylcyclopropan-1-amine.
| Compound Name | N-[(5-chloro-2-nitrophenyl)methyl]-2,2-dimethylcyclopropan-1-amine |
|---|---|
| PubChem CID | 78998674 |
| Molecular Formula | C12H15ClN2O2 |
| Molecular Weight | 254.72 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | N-[(5-chloro-2-nitrophenyl)methyl]-2,2-dimethylcyclopropan-1-amine |
| SMILES | CC1(C)CC1NCc1cc(Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H15ClN2O2/c1-12(2)6-11(12)14-7-8-5-9(13)3-4-10(8)15(16)17/h3-5,11,14H,6-7H2,1-2H3 |
| InChIKey | FEVLYFMHNOJQGC-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.72 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|