C17H18N2O5 — CID 133448075
(1S,2R)-1-(4,5-dimethoxy-2-nitroanilino)-2,3-dihydro-1H-inden-2-ol (PubChem CID 133448075) has the molecular formula C17H18N2O5 and a molecular weight of 330.34 g/mol. Its IUPAC name is (1S,2R)-1-(4,5-dimethoxy-2-nitroanilino)-2,3-dihydro-1H-inden-2-ol.
| Compound Name | (1S,2R)-1-(4,5-dimethoxy-2-nitroanilino)-2,3-dihydro-1H-inden-2-ol |
|---|---|
| PubChem CID | 133448075 |
| Molecular Formula | C17H18N2O5 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | (1S,2R)-1-(4,5-dimethoxy-2-nitroanilino)-2,3-dihydro-1H-inden-2-ol |
| SMILES | COc1cc(N[C@H]2c3ccccc3C[C@H]2O)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C17H18N2O5/c1-23-15-8-12(13(19(21)22)9-16(15)24-2)18-17-11-6-4-3-5-10(11)7-14(17)20/h3-6,8-9,14,17-18,20H,7H2,1-2H3/t14-,17+/m1/s1 |
| InChIKey | BLBYYXNYSUPTFS-PBHICJAKSA-N |
| XLogP | 2.68 |
| TPSA | 93.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|