C14H18BrNO2 — CID 107910801
5-bromo-N-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]pentanamide (PubChem CID 107910801) has the molecular formula C14H18BrNO2 and a molecular weight of 312.21 g/mol. Its IUPAC name is 5-bromo-N-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]pentanamide.
| Compound Name | 5-bromo-N-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]pentanamide |
|---|---|
| PubChem CID | 107910801 |
| Molecular Formula | C14H18BrNO2 |
| Molecular Weight | 312.21 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | 5-bromo-N-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]pentanamide |
| SMILES | O=C(CCCCBr)N[C@@H]1c2ccccc2C[C@@H]1O |
| InChI | InChI=1S/C14H18BrNO2/c15-8-4-3-7-13(18)16-14-11-6-2-1-5-10(11)9-12(14)17/h1-2,5-6,12,14,17H,3-4,7-9H2,(H,16,18)/t12-,14+/m0/s1 |
| InChIKey | ZEQCXEJXBWVPBL-GXTWGEPZSA-N |
| XLogP | 2.33 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.21 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|