C18H19NO2 — CID 10858934
N-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-3-phenylpropanamide (PubChem CID 10858934) has the molecular formula C18H19NO2 and a molecular weight of 281.35 g/mol. Its IUPAC name is N-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-3-phenylpropanamide.
| Compound Name | N-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 10858934 |
| Molecular Formula | C18H19NO2 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | N-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-3-phenylpropanamide |
| SMILES | O=C(CCc1ccccc1)N[C@@H]1c2ccccc2C[C@@H]1O |
| InChI | InChI=1S/C18H19NO2/c20-16-12-14-8-4-5-9-15(14)18(16)19-17(21)11-10-13-6-2-1-3-7-13/h1-9,16,18,20H,10-12H2,(H,19,21)/t16-,18+/m0/s1 |
| InChIKey | CAYYHYXTIWYVOR-FUHWJXTLSA-N |
| XLogP | 2.39 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |