C16H15BrF2N2 — CID 106264362
2-[(3-bromo-2,6-difluorophenyl)methyl]-3,4-dihydro-1H-isoquinolin-7-amine (PubChem CID 106264362) has the molecular formula C16H15BrF2N2 and a molecular weight of 353.21 g/mol. Its IUPAC name is 2-[(3-bromo-2,6-difluorophenyl)methyl]-3,4-dihydro-1H-isoquinolin-7-amine.
| Compound Name | 2-[(3-bromo-2,6-difluorophenyl)methyl]-3,4-dihydro-1H-isoquinolin-7-amine |
|---|---|
| PubChem CID | 106264362 |
| Molecular Formula | C16H15BrF2N2 |
| Molecular Weight | 353.21 g/mol |
| Exact Mass | 352.04 |
| IUPAC Name | 2-[(3-bromo-2,6-difluorophenyl)methyl]-3,4-dihydro-1H-isoquinolin-7-amine |
| SMILES | Nc1ccc2c(c1)CN(Cc1c(F)ccc(Br)c1F)CC2 |
| InChI | InChI=1S/C16H15BrF2N2/c17-14-3-4-15(18)13(16(14)19)9-21-6-5-10-1-2-12(20)7-11(10)8-21/h1-4,7H,5-6,8-9,20H2 |
| InChIKey | RCZKYBHOPWDLCI-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.21 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|