C15H11BrF3N — CID 106269290
1-[(3-bromo-2,6-difluorophenyl)methyl]-6-fluoro-2,3-dihydroindole (PubChem CID 106269290) has the molecular formula C15H11BrF3N and a molecular weight of 342.16 g/mol. Its IUPAC name is 1-[(3-bromo-2,6-difluorophenyl)methyl]-6-fluoro-2,3-dihydroindole.
| Compound Name | 1-[(3-bromo-2,6-difluorophenyl)methyl]-6-fluoro-2,3-dihydroindole |
|---|---|
| PubChem CID | 106269290 |
| Molecular Formula | C15H11BrF3N |
| Molecular Weight | 342.16 g/mol |
| Exact Mass | 341.00 |
| IUPAC Name | 1-[(3-bromo-2,6-difluorophenyl)methyl]-6-fluoro-2,3-dihydroindole |
| SMILES | Fc1ccc2c(c1)N(Cc1c(F)ccc(Br)c1F)CC2 |
| InChI | InChI=1S/C15H11BrF3N/c16-12-3-4-13(18)11(15(12)19)8-20-6-5-9-1-2-10(17)7-14(9)20/h1-4,7H,5-6,8H2 |
| InChIKey | OITHXLURPNDHCZ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.16 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|