C16H13F2NO2 — CID 103503739
5-fluoro-2-[(6-fluoro-2,3-dihydroindol-1-yl)methyl]benzoic acid (PubChem CID 103503739) has the molecular formula C16H13F2NO2 and a molecular weight of 289.28 g/mol. Its IUPAC name is 5-fluoro-2-[(6-fluoro-2,3-dihydroindol-1-yl)methyl]benzoic acid.
| Compound Name | 5-fluoro-2-[(6-fluoro-2,3-dihydroindol-1-yl)methyl]benzoic acid |
|---|---|
| PubChem CID | 103503739 |
| Molecular Formula | C16H13F2NO2 |
| Molecular Weight | 289.28 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 5-fluoro-2-[(6-fluoro-2,3-dihydroindol-1-yl)methyl]benzoic acid |
| SMILES | O=C(O)c1cc(F)ccc1CN1CCc2ccc(F)cc21 |
| InChI | InChI=1S/C16H13F2NO2/c17-12-4-2-11(14(7-12)16(20)21)9-19-6-5-10-1-3-13(18)8-15(10)19/h1-4,7-8H,5-6,9H2,(H,20,21) |
| InChIKey | CXBVJCXRPRVXGJ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.28 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |