C16H14FNO2S — CID 103501685
(E)-3-[5-[(6-fluoro-2,3-dihydroindol-1-yl)methyl]thiophen-2-yl]prop-2-enoic acid (PubChem CID 103501685) has the molecular formula C16H14FNO2S and a molecular weight of 303.36 g/mol. Its IUPAC name is (E)-3-[5-[(6-fluoro-2,3-dihydroindol-1-yl)methyl]thiophen-2-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[5-[(6-fluoro-2,3-dihydroindol-1-yl)methyl]thiophen-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 103501685 |
| Molecular Formula | C16H14FNO2S |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | (E)-3-[5-[(6-fluoro-2,3-dihydroindol-1-yl)methyl]thiophen-2-yl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccc(CN2CCc3ccc(F)cc32)s1 |
| InChI | InChI=1S/C16H14FNO2S/c17-12-2-1-11-7-8-18(15(11)9-12)10-14-4-3-13(21-14)5-6-16(19)20/h1-6,9H,7-8,10H2,(H,19,20)/b6-5+ |
| InChIKey | NGRYOFZFHFDGNL-AATRIKPKSA-N |
| XLogP | 3.55 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|