C15H15FN2O — CID 103494091
4-amino-2-[(6-fluoro-2,3-dihydroindol-1-yl)methyl]phenol (PubChem CID 103494091) has the molecular formula C15H15FN2O and a molecular weight of 258.30 g/mol. Its IUPAC name is 4-amino-2-[(6-fluoro-2,3-dihydroindol-1-yl)methyl]phenol.
| Compound Name | 4-amino-2-[(6-fluoro-2,3-dihydroindol-1-yl)methyl]phenol |
|---|---|
| PubChem CID | 103494091 |
| Molecular Formula | C15H15FN2O |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 4-amino-2-[(6-fluoro-2,3-dihydroindol-1-yl)methyl]phenol |
| SMILES | Nc1ccc(O)c(CN2CCc3ccc(F)cc32)c1 |
| InChI | InChI=1S/C15H15FN2O/c16-12-2-1-10-5-6-18(14(10)8-12)9-11-7-13(17)3-4-15(11)19/h1-4,7-8,19H,5-6,9,17H2 |
| InChIKey | NVDMYQYYSWCDHS-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|