C15H13BrFN — CID 103501587
1-[(4-bromophenyl)methyl]-6-fluoro-2,3-dihydroindole (PubChem CID 103501587) has the molecular formula C15H13BrFN and a molecular weight of 306.18 g/mol. Its IUPAC name is 1-[(4-bromophenyl)methyl]-6-fluoro-2,3-dihydroindole.
| Compound Name | 1-[(4-bromophenyl)methyl]-6-fluoro-2,3-dihydroindole |
|---|---|
| PubChem CID | 103501587 |
| Molecular Formula | C15H13BrFN |
| Molecular Weight | 306.18 g/mol |
| Exact Mass | 305.02 |
| IUPAC Name | 1-[(4-bromophenyl)methyl]-6-fluoro-2,3-dihydroindole |
| SMILES | Fc1ccc2c(c1)N(Cc1ccc(Br)cc1)CC2 |
| InChI | InChI=1S/C15H13BrFN/c16-13-4-1-11(2-5-13)10-18-8-7-12-3-6-14(17)9-15(12)18/h1-6,9H,7-8,10H2 |
| InChIKey | OQKTVRKCCFZISM-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.18 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |