C14H14FN3OS — CID 103503781
3-[(6-fluoro-2,3-dihydroindol-1-yl)methyl]thiophene-2-carbohydrazide (PubChem CID 103503781) has the molecular formula C14H14FN3OS and a molecular weight of 291.35 g/mol. Its IUPAC name is 3-[(6-fluoro-2,3-dihydroindol-1-yl)methyl]thiophene-2-carbohydrazide.
| Compound Name | 3-[(6-fluoro-2,3-dihydroindol-1-yl)methyl]thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 103503781 |
| Molecular Formula | C14H14FN3OS |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | 3-[(6-fluoro-2,3-dihydroindol-1-yl)methyl]thiophene-2-carbohydrazide |
| SMILES | NNC(=O)c1sccc1CN1CCc2ccc(F)cc21 |
| InChI | InChI=1S/C14H14FN3OS/c15-11-2-1-9-3-5-18(12(9)7-11)8-10-4-6-20-13(10)14(19)17-16/h1-2,4,6-7H,3,5,8,16H2,(H,17,19) |
| InChIKey | HMRDJCAFIZXMRZ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|