About 3-[(6-fluoro-2,3-dihydroindol-1-yl)methyl]thiophene-2-carbohydrazide
3-[(6-fluoro-2,3-dihydroindol-1-yl)methyl]thiophene-2-carbohydrazide (PubChem CID 103503781) has the molecular formula C14H14FN3OS
and a molecular weight of 291.35 g/mol. Its IUPAC name is 3-[(6-fluoro-2,3-dihydroindol-1-yl)methyl]thiophene-2-carbohydrazide.
Molecular Properties
| Compound Name | 3-[(6-fluoro-2,3-dihydroindol-1-yl)methyl]thiophene-2-carbohydrazide |
| PubChem CID | 103503781 |
| Molecular Formula | C14H14FN3OS |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | 3-[(6-fluoro-2,3-dihydroindol-1-yl)methyl]thiophene-2-carbohydrazide |
| SMILES | NNC(=O)c1sccc1CN1CCc2ccc(F)cc21 |
| InChI | InChI=1S/C14H14FN3OS/c15-11-2-1-9-3-5-18(12(9)7-11)8-10-4-6-20-13(10)14(19)17-16/h1-2,4,6-7H,3,5,8,16H2,(H,17,19) |
| InChIKey | HMRDJCAFIZXMRZ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[(6-fluoro-2,3-dihydroindol-1-yl)methyl]thiophene-2-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(6-fluoro-2,3-dihydroindol-1-yl)methyl]thiophene-2-carbohydrazide?
The IUPAC name of 3-[(6-fluoro-2,3-dihydroindol-1-yl)methyl]thiophene-2-carbohydrazide (CID 103503781) is 3-[(6-fluoro-2,3-dihydroindol-1-yl)methyl]thiophene-2-carbohydrazide.
What is the SMILES notation for 3-[(6-fluoro-2,3-dihydroindol-1-yl)methyl]thiophene-2-carbohydrazide?
The canonical SMILES for 3-[(6-fluoro-2,3-dihydroindol-1-yl)methyl]thiophene-2-carbohydrazide is NNC(=O)c1sccc1CN1CCc2ccc(F)cc21.
What is the InChIKey of 3-[(6-fluoro-2,3-dihydroindol-1-yl)methyl]thiophene-2-carbohydrazide?
The InChIKey is HMRDJCAFIZXMRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14FN3OS/c15-11-2-1-9-3-5-18(12(9)7-11)8-10-4-6-20-13(10)14(19)17-16/h1-2,4,6-7H,3,5,8,16H2,(H,17,19).
What are the key properties of 3-[(6-fluoro-2,3-dihydroindol-1-yl)methyl]thiophene-2-carbohydrazide?
3-[(6-fluoro-2,3-dihydroindol-1-yl)methyl]thiophene-2-carbohydrazide has a molecular weight of 291.35 g/mol, XLogP of 2.05, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(6-fluoro-2,3-dihydroindol-1-yl)methyl]thiophene-2-carbohydrazide is sourced from PubChem (CID 103503781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).