C13H13FN4OS — CID 103503789
4-[(6-fluoro-2,3-dihydroindol-1-yl)methyl]-1,3-thiazole-2-carbohydrazide (PubChem CID 103503789) has the molecular formula C13H13FN4OS and a molecular weight of 292.34 g/mol. Its IUPAC name is 4-[(6-fluoro-2,3-dihydroindol-1-yl)methyl]-1,3-thiazole-2-carbohydrazide.
| Compound Name | 4-[(6-fluoro-2,3-dihydroindol-1-yl)methyl]-1,3-thiazole-2-carbohydrazide |
|---|---|
| PubChem CID | 103503789 |
| Molecular Formula | C13H13FN4OS |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | 4-[(6-fluoro-2,3-dihydroindol-1-yl)methyl]-1,3-thiazole-2-carbohydrazide |
| SMILES | NNC(=O)c1nc(CN2CCc3ccc(F)cc32)cs1 |
| InChI | InChI=1S/C13H13FN4OS/c14-9-2-1-8-3-4-18(11(8)5-9)6-10-7-20-13(16-10)12(19)17-15/h1-2,5,7H,3-4,6,15H2,(H,17,19) |
| InChIKey | OLIQVSVQKWXIKI-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|