C9H12N4O2S — CID 63572610
4-[(2-oxopyrrolidin-1-yl)methyl]-1,3-thiazole-2-carbohydrazide (PubChem CID 63572610) has the molecular formula C9H12N4O2S and a molecular weight of 240.29 g/mol. Its IUPAC name is 4-[(2-oxopyrrolidin-1-yl)methyl]-1,3-thiazole-2-carbohydrazide.
| Compound Name | 4-[(2-oxopyrrolidin-1-yl)methyl]-1,3-thiazole-2-carbohydrazide |
|---|---|
| PubChem CID | 63572610 |
| Molecular Formula | C9H12N4O2S |
| Molecular Weight | 240.29 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | 4-[(2-oxopyrrolidin-1-yl)methyl]-1,3-thiazole-2-carbohydrazide |
| SMILES | NNC(=O)c1nc(CN2CCCC2=O)cs1 |
| InChI | InChI=1S/C9H12N4O2S/c10-12-8(15)9-11-6(5-16-9)4-13-3-1-2-7(13)14/h5H,1-4,10H2,(H,12,15) |
| InChIKey | KVWWJRLLWILMDT-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.29 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|