C12H21N5O2S — CID 107226638
4-[[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]methyl]-1,3-thiazole-2-carbohydrazide (PubChem CID 107226638) has the molecular formula C12H21N5O2S and a molecular weight of 299.40 g/mol. Its IUPAC name is 4-[[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]methyl]-1,3-thiazole-2-carbohydrazide.
| Compound Name | 4-[[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]methyl]-1,3-thiazole-2-carbohydrazide |
|---|---|
| PubChem CID | 107226638 |
| Molecular Formula | C12H21N5O2S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | 4-[[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]methyl]-1,3-thiazole-2-carbohydrazide |
| SMILES | NNC(=O)c1nc(CN2CCCN(CCO)CC2)cs1 |
| InChI | InChI=1S/C12H21N5O2S/c13-15-11(19)12-14-10(9-20-12)8-17-3-1-2-16(4-5-17)6-7-18/h9,18H,1-8,13H2,(H,15,19) |
| InChIKey | IUZKYZXRROTONJ-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 94.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|