C12H21N5OS — CID 55212863
4-[[methyl(2-pyrrolidin-1-ylethyl)amino]methyl]-1,3-thiazole-2-carbohydrazide (PubChem CID 55212863) has the molecular formula C12H21N5OS and a molecular weight of 283.40 g/mol. Its IUPAC name is 4-[[methyl(2-pyrrolidin-1-ylethyl)amino]methyl]-1,3-thiazole-2-carbohydrazide.
| Compound Name | 4-[[methyl(2-pyrrolidin-1-ylethyl)amino]methyl]-1,3-thiazole-2-carbohydrazide |
|---|---|
| PubChem CID | 55212863 |
| Molecular Formula | C12H21N5OS |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | 4-[[methyl(2-pyrrolidin-1-ylethyl)amino]methyl]-1,3-thiazole-2-carbohydrazide |
| SMILES | CN(CCN1CCCC1)Cc1csc(C(=O)NN)n1 |
| InChI | InChI=1S/C12H21N5OS/c1-16(6-7-17-4-2-3-5-17)8-10-9-19-12(14-10)11(18)15-13/h9H,2-8,13H2,1H3,(H,15,18) |
| InChIKey | JKRQMYKOVMRZFF-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|