C8H11F3N4OS — CID 63571833
4-[[methyl(2,2,2-trifluoroethyl)amino]methyl]-1,3-thiazole-2-carbohydrazide (PubChem CID 63571833) has the molecular formula C8H11F3N4OS and a molecular weight of 268.26 g/mol. Its IUPAC name is 4-[[methyl(2,2,2-trifluoroethyl)amino]methyl]-1,3-thiazole-2-carbohydrazide.
| Compound Name | 4-[[methyl(2,2,2-trifluoroethyl)amino]methyl]-1,3-thiazole-2-carbohydrazide |
|---|---|
| PubChem CID | 63571833 |
| Molecular Formula | C8H11F3N4OS |
| Molecular Weight | 268.26 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | 4-[[methyl(2,2,2-trifluoroethyl)amino]methyl]-1,3-thiazole-2-carbohydrazide |
| SMILES | CN(Cc1csc(C(=O)NN)n1)CC(F)(F)F |
| InChI | InChI=1S/C8H11F3N4OS/c1-15(4-8(9,10)11)2-5-3-17-7(13-5)6(16)14-12/h3H,2,4,12H2,1H3,(H,14,16) |
| InChIKey | ZSLNBINIOCCIRZ-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.26 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|