C9H16N4OS2 — CID 66229682
4-[(2-amino-2-methylpropyl)sulfanylmethyl]-1,3-thiazole-2-carbohydrazide (PubChem CID 66229682) has the molecular formula C9H16N4OS2 and a molecular weight of 260.39 g/mol. Its IUPAC name is 4-[(2-amino-2-methylpropyl)sulfanylmethyl]-1,3-thiazole-2-carbohydrazide.
| Compound Name | 4-[(2-amino-2-methylpropyl)sulfanylmethyl]-1,3-thiazole-2-carbohydrazide |
|---|---|
| PubChem CID | 66229682 |
| Molecular Formula | C9H16N4OS2 |
| Molecular Weight | 260.39 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 4-[(2-amino-2-methylpropyl)sulfanylmethyl]-1,3-thiazole-2-carbohydrazide |
| SMILES | CC(C)(N)CSCc1csc(C(=O)NN)n1 |
| InChI | InChI=1S/C9H16N4OS2/c1-9(2,10)5-15-3-6-4-16-8(12-6)7(14)13-11/h4H,3,5,10-11H2,1-2H3,(H,13,14) |
| InChIKey | DJIXITXXPWWXMZ-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.39 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|