C8H13N3O3S2 — CID 79670600
4-(2,3-dihydroxypropylsulfanylmethyl)-1,3-thiazole-2-carbohydrazide (PubChem CID 79670600) has the molecular formula C8H13N3O3S2 and a molecular weight of 263.34 g/mol. Its IUPAC name is 4-(2,3-dihydroxypropylsulfanylmethyl)-1,3-thiazole-2-carbohydrazide.
| Compound Name | 4-(2,3-dihydroxypropylsulfanylmethyl)-1,3-thiazole-2-carbohydrazide |
|---|---|
| PubChem CID | 79670600 |
| Molecular Formula | C8H13N3O3S2 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.04 |
| IUPAC Name | 4-(2,3-dihydroxypropylsulfanylmethyl)-1,3-thiazole-2-carbohydrazide |
| SMILES | NNC(=O)c1nc(CSCC(O)CO)cs1 |
| InChI | InChI=1S/C8H13N3O3S2/c9-11-7(14)8-10-5(3-16-8)2-15-4-6(13)1-12/h3,6,12-13H,1-2,4,9H2,(H,11,14) |
| InChIKey | QLWNRFPGIMNWMC-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|