C8H11N3O3S2 — CID 63580308
methyl 2-[[2-(hydrazinecarbonyl)-1,3-thiazol-4-yl]methylsulfanyl]acetate (PubChem CID 63580308) has the molecular formula C8H11N3O3S2 and a molecular weight of 261.33 g/mol. Its IUPAC name is methyl 2-[[2-(hydrazinecarbonyl)-1,3-thiazol-4-yl]methylsulfanyl]acetate.
| Compound Name | methyl 2-[[2-(hydrazinecarbonyl)-1,3-thiazol-4-yl]methylsulfanyl]acetate |
|---|---|
| PubChem CID | 63580308 |
| Molecular Formula | C8H11N3O3S2 |
| Molecular Weight | 261.33 g/mol |
| Exact Mass | 261.02 |
| IUPAC Name | methyl 2-[[2-(hydrazinecarbonyl)-1,3-thiazol-4-yl]methylsulfanyl]acetate |
| SMILES | COC(=O)CSCc1csc(C(=O)NN)n1 |
| InChI | InChI=1S/C8H11N3O3S2/c1-14-6(12)4-15-2-5-3-16-8(10-5)7(13)11-9/h3H,2,4,9H2,1H3,(H,11,13) |
| InChIKey | IMUMZIVMVXIVKD-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.33 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|