C12H13N3OS2 — CID 63579999
4-[(3-methylphenyl)sulfanylmethyl]-1,3-thiazole-2-carbohydrazide (PubChem CID 63579999) has the molecular formula C12H13N3OS2 and a molecular weight of 279.39 g/mol. Its IUPAC name is 4-[(3-methylphenyl)sulfanylmethyl]-1,3-thiazole-2-carbohydrazide.
| Compound Name | 4-[(3-methylphenyl)sulfanylmethyl]-1,3-thiazole-2-carbohydrazide |
|---|---|
| PubChem CID | 63579999 |
| Molecular Formula | C12H13N3OS2 |
| Molecular Weight | 279.39 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | 4-[(3-methylphenyl)sulfanylmethyl]-1,3-thiazole-2-carbohydrazide |
| SMILES | Cc1cccc(SCc2csc(C(=O)NN)n2)c1 |
| InChI | InChI=1S/C12H13N3OS2/c1-8-3-2-4-10(5-8)17-6-9-7-18-12(14-9)11(16)15-13/h2-5,7H,6,13H2,1H3,(H,15,16) |
| InChIKey | PDLRZNMTFRCLIT-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.39 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|