C10H11N5OS2 — CID 63580507
4-[(4-methylpyrimidin-2-yl)sulfanylmethyl]-1,3-thiazole-2-carbohydrazide (PubChem CID 63580507) has the molecular formula C10H11N5OS2 and a molecular weight of 281.37 g/mol. Its IUPAC name is 4-[(4-methylpyrimidin-2-yl)sulfanylmethyl]-1,3-thiazole-2-carbohydrazide.
| Compound Name | 4-[(4-methylpyrimidin-2-yl)sulfanylmethyl]-1,3-thiazole-2-carbohydrazide |
|---|---|
| PubChem CID | 63580507 |
| Molecular Formula | C10H11N5OS2 |
| Molecular Weight | 281.37 g/mol |
| Exact Mass | 281.04 |
| IUPAC Name | 4-[(4-methylpyrimidin-2-yl)sulfanylmethyl]-1,3-thiazole-2-carbohydrazide |
| SMILES | Cc1ccnc(SCc2csc(C(=O)NN)n2)n1 |
| InChI | InChI=1S/C10H11N5OS2/c1-6-2-3-12-10(13-6)18-5-7-4-17-9(14-7)8(16)15-11/h2-4H,5,11H2,1H3,(H,15,16) |
| InChIKey | PXOKENGCMATCQV-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.37 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|