C9H9N5OS2 — CID 63696092
4-(pyrimidin-4-ylsulfanylmethyl)-1,3-thiazole-2-carbohydrazide (PubChem CID 63696092) has the molecular formula C9H9N5OS2 and a molecular weight of 267.34 g/mol. Its IUPAC name is 4-(pyrimidin-4-ylsulfanylmethyl)-1,3-thiazole-2-carbohydrazide.
| Compound Name | 4-(pyrimidin-4-ylsulfanylmethyl)-1,3-thiazole-2-carbohydrazide |
|---|---|
| PubChem CID | 63696092 |
| Molecular Formula | C9H9N5OS2 |
| Molecular Weight | 267.34 g/mol |
| Exact Mass | 267.02 |
| IUPAC Name | 4-(pyrimidin-4-ylsulfanylmethyl)-1,3-thiazole-2-carbohydrazide |
| SMILES | NNC(=O)c1nc(CSc2ccncn2)cs1 |
| InChI | InChI=1S/C9H9N5OS2/c10-14-8(15)9-13-6(4-17-9)3-16-7-1-2-11-5-12-7/h1-2,4-5H,3,10H2,(H,14,15) |
| InChIKey | CFBWDCQKNDQMTI-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.34 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|