C13H16N4O2S2 — CID 79515830
4-[(2-amino-5-ethoxyphenyl)sulfanylmethyl]-1,3-thiazole-2-carbohydrazide (PubChem CID 79515830) has the molecular formula C13H16N4O2S2 and a molecular weight of 324.43 g/mol. Its IUPAC name is 4-[(2-amino-5-ethoxyphenyl)sulfanylmethyl]-1,3-thiazole-2-carbohydrazide.
| Compound Name | 4-[(2-amino-5-ethoxyphenyl)sulfanylmethyl]-1,3-thiazole-2-carbohydrazide |
|---|---|
| PubChem CID | 79515830 |
| Molecular Formula | C13H16N4O2S2 |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | 4-[(2-amino-5-ethoxyphenyl)sulfanylmethyl]-1,3-thiazole-2-carbohydrazide |
| SMILES | CCOc1ccc(N)c(SCc2csc(C(=O)NN)n2)c1 |
| InChI | InChI=1S/C13H16N4O2S2/c1-2-19-9-3-4-10(14)11(5-9)20-6-8-7-21-13(16-8)12(18)17-15/h3-5,7H,2,6,14-15H2,1H3,(H,17,18) |
| InChIKey | VLKYPDUBYFCPRQ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 103.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|