C15H20N2OS2 — CID 79527451
4-ethoxy-2-[(2-propan-2-yl-1,3-thiazol-4-yl)methylsulfanyl]aniline (PubChem CID 79527451) has the molecular formula C15H20N2OS2 and a molecular weight of 308.47 g/mol. Its IUPAC name is 4-ethoxy-2-[(2-propan-2-yl-1,3-thiazol-4-yl)methylsulfanyl]aniline.
| Compound Name | 4-ethoxy-2-[(2-propan-2-yl-1,3-thiazol-4-yl)methylsulfanyl]aniline |
|---|---|
| PubChem CID | 79527451 |
| Molecular Formula | C15H20N2OS2 |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | 4-ethoxy-2-[(2-propan-2-yl-1,3-thiazol-4-yl)methylsulfanyl]aniline |
| SMILES | CCOc1ccc(N)c(SCc2csc(C(C)C)n2)c1 |
| InChI | InChI=1S/C15H20N2OS2/c1-4-18-12-5-6-13(16)14(7-12)19-8-11-9-20-15(17-11)10(2)3/h5-7,9-10H,4,8,16H2,1-3H3 |
| InChIKey | YVCVKYFBWIRKJI-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|