C10H10N4OS2 — CID 63580249
4-(pyridin-2-ylsulfanylmethyl)-1,3-thiazole-2-carbohydrazide (PubChem CID 63580249) has the molecular formula C10H10N4OS2 and a molecular weight of 266.35 g/mol. Its IUPAC name is 4-(pyridin-2-ylsulfanylmethyl)-1,3-thiazole-2-carbohydrazide.
| Compound Name | 4-(pyridin-2-ylsulfanylmethyl)-1,3-thiazole-2-carbohydrazide |
|---|---|
| PubChem CID | 63580249 |
| Molecular Formula | C10H10N4OS2 |
| Molecular Weight | 266.35 g/mol |
| Exact Mass | 266.03 |
| IUPAC Name | 4-(pyridin-2-ylsulfanylmethyl)-1,3-thiazole-2-carbohydrazide |
| SMILES | NNC(=O)c1nc(CSc2ccccn2)cs1 |
| InChI | InChI=1S/C10H10N4OS2/c11-14-9(15)10-13-7(6-17-10)5-16-8-3-1-2-4-12-8/h1-4,6H,5,11H2,(H,14,15) |
| InChIKey | HHXIJLRRPLBMLH-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.35 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|