C11H11N3OS2 — CID 29437348
N-[4-(pyridin-2-ylsulfanylmethyl)-1,3-thiazol-2-yl]acetamide (PubChem CID 29437348) has the molecular formula C11H11N3OS2 and a molecular weight of 265.36 g/mol. Its IUPAC name is N-[4-(pyridin-2-ylsulfanylmethyl)-1,3-thiazol-2-yl]acetamide.
| Compound Name | N-[4-(pyridin-2-ylsulfanylmethyl)-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 29437348 |
| Molecular Formula | C11H11N3OS2 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.03 |
| IUPAC Name | N-[4-(pyridin-2-ylsulfanylmethyl)-1,3-thiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1nc(CSc2ccccn2)cs1 |
| InChI | InChI=1S/C11H11N3OS2/c1-8(15)13-11-14-9(7-17-11)6-16-10-4-2-3-5-12-10/h2-5,7H,6H2,1H3,(H,13,14,15) |
| InChIKey | WDOSRQMDAHSKNE-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |