C12H22N4O2S — CID 63584999
4-[[2-hydroxyethyl(pentan-3-yl)amino]methyl]-1,3-thiazole-2-carbohydrazide (PubChem CID 63584999) has the molecular formula C12H22N4O2S and a molecular weight of 286.40 g/mol. Its IUPAC name is 4-[[2-hydroxyethyl(pentan-3-yl)amino]methyl]-1,3-thiazole-2-carbohydrazide.
| Compound Name | 4-[[2-hydroxyethyl(pentan-3-yl)amino]methyl]-1,3-thiazole-2-carbohydrazide |
|---|---|
| PubChem CID | 63584999 |
| Molecular Formula | C12H22N4O2S |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | 4-[[2-hydroxyethyl(pentan-3-yl)amino]methyl]-1,3-thiazole-2-carbohydrazide |
| SMILES | CCC(CC)N(CCO)Cc1csc(C(=O)NN)n1 |
| InChI | InChI=1S/C12H22N4O2S/c1-3-10(4-2)16(5-6-17)7-9-8-19-12(14-9)11(18)15-13/h8,10,17H,3-7,13H2,1-2H3,(H,15,18) |
| InChIKey | GHXNVKYLPDFTAA-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 91.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|