C12H22N4OS — CID 63579824
4-[[methyl(4-methylpentan-2-yl)amino]methyl]-1,3-thiazole-2-carbohydrazide (PubChem CID 63579824) has the molecular formula C12H22N4OS and a molecular weight of 270.40 g/mol. Its IUPAC name is 4-[[methyl(4-methylpentan-2-yl)amino]methyl]-1,3-thiazole-2-carbohydrazide.
| Compound Name | 4-[[methyl(4-methylpentan-2-yl)amino]methyl]-1,3-thiazole-2-carbohydrazide |
|---|---|
| PubChem CID | 63579824 |
| Molecular Formula | C12H22N4OS |
| Molecular Weight | 270.40 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | 4-[[methyl(4-methylpentan-2-yl)amino]methyl]-1,3-thiazole-2-carbohydrazide |
| SMILES | CC(C)CC(C)N(C)Cc1csc(C(=O)NN)n1 |
| InChI | InChI=1S/C12H22N4OS/c1-8(2)5-9(3)16(4)6-10-7-18-12(14-10)11(17)15-13/h7-9H,5-6,13H2,1-4H3,(H,15,17) |
| InChIKey | GUODFXPTAYBGFA-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.40 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|