C15H20N4OS — CID 63568512
4-[[benzyl(propan-2-yl)amino]methyl]-1,3-thiazole-2-carbohydrazide (PubChem CID 63568512) has the molecular formula C15H20N4OS and a molecular weight of 304.42 g/mol. Its IUPAC name is 4-[[benzyl(propan-2-yl)amino]methyl]-1,3-thiazole-2-carbohydrazide.
| Compound Name | 4-[[benzyl(propan-2-yl)amino]methyl]-1,3-thiazole-2-carbohydrazide |
|---|---|
| PubChem CID | 63568512 |
| Molecular Formula | C15H20N4OS |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 4-[[benzyl(propan-2-yl)amino]methyl]-1,3-thiazole-2-carbohydrazide |
| SMILES | CC(C)N(Cc1ccccc1)Cc1csc(C(=O)NN)n1 |
| InChI | InChI=1S/C15H20N4OS/c1-11(2)19(8-12-6-4-3-5-7-12)9-13-10-21-15(17-13)14(20)18-16/h3-7,10-11H,8-9,16H2,1-2H3,(H,18,20) |
| InChIKey | FSJICXNGCRQVHH-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|