C8H10N2O2S — CID 130547609
4-(azetidin-1-ylmethyl)-1,3-thiazole-2-carboxylic acid (PubChem CID 130547609) has the molecular formula C8H10N2O2S and a molecular weight of 198.25 g/mol. Its IUPAC name is 4-(azetidin-1-ylmethyl)-1,3-thiazole-2-carboxylic acid.
| Compound Name | 4-(azetidin-1-ylmethyl)-1,3-thiazole-2-carboxylic acid |
|---|---|
| PubChem CID | 130547609 |
| Molecular Formula | C8H10N2O2S |
| Molecular Weight | 198.25 g/mol |
| Exact Mass | 198.05 |
| IUPAC Name | 4-(azetidin-1-ylmethyl)-1,3-thiazole-2-carboxylic acid |
| SMILES | O=C(O)c1nc(CN2CCC2)cs1 |
| InChI | InChI=1S/C8H10N2O2S/c11-8(12)7-9-6(5-13-7)4-10-2-1-3-10/h5H,1-4H2,(H,11,12) |
| InChIKey | SUJJSSCDZWAPFR-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.25 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |