4-(azetidin-1-ylmethyl)-1,3-thiazole-2-carboxylic acid

C8H10N2O2S — CID 130547609

IUPAC4-(azetidin-1-ylmethyl)-1,3-thiazole-2-carboxylic acid
SMILESO=C(O)c1nc(CN2CCC2)cs1
InChIInChI=1S/C8H10N2O2S/c11-8(12)7-9-6(5-13-7)4-10-2-1-3-10/h5H,1-4H2,(H,11,12)
InChIKeySUJJSSCDZWAPFR-UHFFFAOYSA-N
MW198.25 g/mol
LogP1.05
Rot. Bonds3

About 4-(azetidin-1-ylmethyl)-1,3-thiazole-2-carboxylic acid

4-(azetidin-1-ylmethyl)-1,3-thiazole-2-carboxylic acid (PubChem CID 130547609) has the molecular formula C8H10N2O2S and a molecular weight of 198.25 g/mol. Its IUPAC name is 4-(azetidin-1-ylmethyl)-1,3-thiazole-2-carboxylic acid.

Molecular Properties

Compound Name4-(azetidin-1-ylmethyl)-1,3-thiazole-2-carboxylic acid
PubChem CID130547609
Molecular FormulaC8H10N2O2S
Molecular Weight198.25 g/mol
Exact Mass198.05
IUPAC Name4-(azetidin-1-ylmethyl)-1,3-thiazole-2-carboxylic acid
SMILESO=C(O)c1nc(CN2CCC2)cs1
InChIInChI=1S/C8H10N2O2S/c11-8(12)7-9-6(5-13-7)4-10-2-1-3-10/h5H,1-4H2,(H,11,12)
InChIKeySUJJSSCDZWAPFR-UHFFFAOYSA-N
XLogP1.05
TPSA53.43 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500198.25
LogP ≤ 51.05
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 4-(azetidin-1-ylmethyl)-1,3-thiazole-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(azetidin-1-ylmethyl)-1,3-thiazole-2-carboxylic acid?
The IUPAC name of 4-(azetidin-1-ylmethyl)-1,3-thiazole-2-carboxylic acid (CID 130547609) is 4-(azetidin-1-ylmethyl)-1,3-thiazole-2-carboxylic acid.
What is the SMILES notation for 4-(azetidin-1-ylmethyl)-1,3-thiazole-2-carboxylic acid?
The canonical SMILES for 4-(azetidin-1-ylmethyl)-1,3-thiazole-2-carboxylic acid is O=C(O)c1nc(CN2CCC2)cs1.
What is the InChIKey of 4-(azetidin-1-ylmethyl)-1,3-thiazole-2-carboxylic acid?
The InChIKey is SUJJSSCDZWAPFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O2S/c11-8(12)7-9-6(5-13-7)4-10-2-1-3-10/h5H,1-4H2,(H,11,12).
What are the key properties of 4-(azetidin-1-ylmethyl)-1,3-thiazole-2-carboxylic acid?
4-(azetidin-1-ylmethyl)-1,3-thiazole-2-carboxylic acid has a molecular weight of 198.25 g/mol, XLogP of 1.05, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(azetidin-1-ylmethyl)-1,3-thiazole-2-carboxylic acid is sourced from PubChem (CID 130547609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).