C17H16FNOS — CID 103501668
4-[2-[(6-fluoro-2,3-dihydroindol-1-yl)methyl]thiophen-3-yl]but-3-yn-1-ol (PubChem CID 103501668) has the molecular formula C17H16FNOS and a molecular weight of 301.39 g/mol. Its IUPAC name is 4-[2-[(6-fluoro-2,3-dihydroindol-1-yl)methyl]thiophen-3-yl]but-3-yn-1-ol.
| Compound Name | 4-[2-[(6-fluoro-2,3-dihydroindol-1-yl)methyl]thiophen-3-yl]but-3-yn-1-ol |
|---|---|
| PubChem CID | 103501668 |
| Molecular Formula | C17H16FNOS |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | 4-[2-[(6-fluoro-2,3-dihydroindol-1-yl)methyl]thiophen-3-yl]but-3-yn-1-ol |
| SMILES | OCCC#Cc1ccsc1CN1CCc2ccc(F)cc21 |
| InChI | InChI=1S/C17H16FNOS/c18-15-5-4-13-6-8-19(16(13)11-15)12-17-14(7-10-21-17)3-1-2-9-20/h4-5,7,10-11,20H,2,6,8-9,12H2 |
| InChIKey | CSEXGSGHHDWWNA-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|