C10H15N3O3S — CID 106674279
3-[(3,4-dihydroxypyrrolidin-1-yl)methyl]thiophene-2-carbohydrazide (PubChem CID 106674279) has the molecular formula C10H15N3O3S and a molecular weight of 257.31 g/mol. Its IUPAC name is 3-[(3,4-dihydroxypyrrolidin-1-yl)methyl]thiophene-2-carbohydrazide.
| Compound Name | 3-[(3,4-dihydroxypyrrolidin-1-yl)methyl]thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 106674279 |
| Molecular Formula | C10H15N3O3S |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | 3-[(3,4-dihydroxypyrrolidin-1-yl)methyl]thiophene-2-carbohydrazide |
| SMILES | NNC(=O)c1sccc1CN1CC(O)C(O)C1 |
| InChI | InChI=1S/C10H15N3O3S/c11-12-10(16)9-6(1-2-17-9)3-13-4-7(14)8(15)5-13/h1-2,7-8,14-15H,3-5,11H2,(H,12,16) |
| InChIKey | NCYIUDSFFYVZTJ-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|