C13H13BrF2N2O2 — CID 106269330
1-[(3-bromo-2,6-difluorophenyl)methyl]-4-ethylpiperazine-2,3-dione (PubChem CID 106269330) has the molecular formula C13H13BrF2N2O2 and a molecular weight of 347.16 g/mol. Its IUPAC name is 1-[(3-bromo-2,6-difluorophenyl)methyl]-4-ethylpiperazine-2,3-dione.
| Compound Name | 1-[(3-bromo-2,6-difluorophenyl)methyl]-4-ethylpiperazine-2,3-dione |
|---|---|
| PubChem CID | 106269330 |
| Molecular Formula | C13H13BrF2N2O2 |
| Molecular Weight | 347.16 g/mol |
| Exact Mass | 346.01 |
| IUPAC Name | 1-[(3-bromo-2,6-difluorophenyl)methyl]-4-ethylpiperazine-2,3-dione |
| SMILES | CCN1CCN(Cc2c(F)ccc(Br)c2F)C(=O)C1=O |
| InChI | InChI=1S/C13H13BrF2N2O2/c1-2-17-5-6-18(13(20)12(17)19)7-8-10(15)4-3-9(14)11(8)16/h3-4H,2,5-7H2,1H3 |
| InChIKey | NXHGDNABEAPXMK-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.16 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|