C10H7BrF2N2O2 — CID 106266616
1-[(3-bromo-2,6-difluorophenyl)methyl]imidazolidine-2,4-dione (PubChem CID 106266616) has the molecular formula C10H7BrF2N2O2 and a molecular weight of 305.08 g/mol. Its IUPAC name is 1-[(3-bromo-2,6-difluorophenyl)methyl]imidazolidine-2,4-dione.
| Compound Name | 1-[(3-bromo-2,6-difluorophenyl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 106266616 |
| Molecular Formula | C10H7BrF2N2O2 |
| Molecular Weight | 305.08 g/mol |
| Exact Mass | 303.97 |
| IUPAC Name | 1-[(3-bromo-2,6-difluorophenyl)methyl]imidazolidine-2,4-dione |
| SMILES | O=C1CN(Cc2c(F)ccc(Br)c2F)C(=O)N1 |
| InChI | InChI=1S/C10H7BrF2N2O2/c11-6-1-2-7(12)5(9(6)13)3-15-4-8(16)14-10(15)17/h1-2H,3-4H2,(H,14,16,17) |
| InChIKey | UVQGPFBJUPYCEJ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.08 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|