C16H17FN2 — CID 39358153
2-[(4-fluorophenyl)methyl]-3,4-dihydro-1H-isoquinolin-7-amine (PubChem CID 39358153) has the molecular formula C16H17FN2 and a molecular weight of 256.32 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methyl]-3,4-dihydro-1H-isoquinolin-7-amine.
| Compound Name | 2-[(4-fluorophenyl)methyl]-3,4-dihydro-1H-isoquinolin-7-amine |
|---|---|
| PubChem CID | 39358153 |
| Molecular Formula | C16H17FN2 |
| Molecular Weight | 256.32 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | 2-[(4-fluorophenyl)methyl]-3,4-dihydro-1H-isoquinolin-7-amine |
| SMILES | Nc1ccc2c(c1)CN(Cc1ccc(F)cc1)CC2 |
| InChI | InChI=1S/C16H17FN2/c17-15-4-1-12(2-5-15)10-19-8-7-13-3-6-16(18)9-14(13)11-19/h1-6,9H,7-8,10-11,18H2 |
| InChIKey | BVHDVVANFMRZSP-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.32 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|