C16H14BrF2NO — CID 106268987
4-[(3-bromo-2,6-difluorophenyl)methyl]-3,5-dihydro-2H-1,4-benzoxazepine (PubChem CID 106268987) has the molecular formula C16H14BrF2NO and a molecular weight of 354.19 g/mol. Its IUPAC name is 4-[(3-bromo-2,6-difluorophenyl)methyl]-3,5-dihydro-2H-1,4-benzoxazepine.
| Compound Name | 4-[(3-bromo-2,6-difluorophenyl)methyl]-3,5-dihydro-2H-1,4-benzoxazepine |
|---|---|
| PubChem CID | 106268987 |
| Molecular Formula | C16H14BrF2NO |
| Molecular Weight | 354.19 g/mol |
| Exact Mass | 353.02 |
| IUPAC Name | 4-[(3-bromo-2,6-difluorophenyl)methyl]-3,5-dihydro-2H-1,4-benzoxazepine |
| SMILES | Fc1ccc(Br)c(F)c1CN1CCOc2ccccc2C1 |
| InChI | InChI=1S/C16H14BrF2NO/c17-13-5-6-14(18)12(16(13)19)10-20-7-8-21-15-4-2-1-3-11(15)9-20/h1-6H,7-10H2 |
| InChIKey | KSJTXYYDMHKLQW-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.19 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|