C13H14BrF2NO — CID 106269097
3-[(3-bromo-2,6-difluorophenyl)methyl]-8-oxa-3-azabicyclo[3.2.1]octane (PubChem CID 106269097) has the molecular formula C13H14BrF2NO and a molecular weight of 318.16 g/mol. Its IUPAC name is 3-[(3-bromo-2,6-difluorophenyl)methyl]-8-oxa-3-azabicyclo[3.2.1]octane.
| Compound Name | 3-[(3-bromo-2,6-difluorophenyl)methyl]-8-oxa-3-azabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 106269097 |
| Molecular Formula | C13H14BrF2NO |
| Molecular Weight | 318.16 g/mol |
| Exact Mass | 317.02 |
| IUPAC Name | 3-[(3-bromo-2,6-difluorophenyl)methyl]-8-oxa-3-azabicyclo[3.2.1]octane |
| SMILES | Fc1ccc(Br)c(F)c1CN1CC2CCC(C1)O2 |
| InChI | InChI=1S/C13H14BrF2NO/c14-11-3-4-12(15)10(13(11)16)7-17-5-8-1-2-9(6-17)18-8/h3-4,8-9H,1-2,5-7H2 |
| InChIKey | NFDIDPTYUGDDEA-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.16 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|