C14H17BrClF2NO — CID 106272398
1-[(3-bromo-2,6-difluorophenyl)methyl]-4-(2-chloroethoxy)piperidine (PubChem CID 106272398) has the molecular formula C14H17BrClF2NO and a molecular weight of 368.65 g/mol. Its IUPAC name is 1-[(3-bromo-2,6-difluorophenyl)methyl]-4-(2-chloroethoxy)piperidine.
| Compound Name | 1-[(3-bromo-2,6-difluorophenyl)methyl]-4-(2-chloroethoxy)piperidine |
|---|---|
| PubChem CID | 106272398 |
| Molecular Formula | C14H17BrClF2NO |
| Molecular Weight | 368.65 g/mol |
| Exact Mass | 367.02 |
| IUPAC Name | 1-[(3-bromo-2,6-difluorophenyl)methyl]-4-(2-chloroethoxy)piperidine |
| SMILES | Fc1ccc(Br)c(F)c1CN1CCC(OCCCl)CC1 |
| InChI | InChI=1S/C14H17BrClF2NO/c15-12-1-2-13(17)11(14(12)18)9-19-6-3-10(4-7-19)20-8-5-16/h1-2,10H,3-9H2 |
| InChIKey | YYLGCEHXFILQHD-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.65 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|